Compound Q&A

How is (2E)-2-Cyano-3-[5-(1-cyclohexyl-1,6-dihydroimidazo[4,5-d]pyrrolo[2,3-b]pyridin-2-yl)-2-furyl]-N,N-dimethylacrylamide (CAS: 2226521-65-7) typically synthesized?

Answer

(2E)-2-Cyano-3-[5-(1-cyclohexyl-1,6-dihydroimidazo[4,5-d]pyrrolo[2,3-b]pyridin-2-yl)-2-furyl]-N,N-dimethylacrylamide
This compound is synthesized via a multistep process involving the condensation of a cyclohexyl-1,6-dihydroimidazo[4,5-d]pyrrolo[2,3-b]pyridin-2-yl derivative with a 2-furyl cyanoacrylamide. The reaction is typically catalyzed by a palladium complex and proceeds in an organic solvent like DMF. The yield is moderate to good, and the selectivity is high, with a single diastereomer being formed.

About

English Name (2E)-2-Cyano-3-[5-(1-cyclohexyl-1,6-dihydroimidazo[4,5-d]pyrrolo[2,3-b]pyridin-2-yl)-2-furyl]-N,N-dimethylacrylamide
Molecular Formula C24H24N6O2
Molecular Weight 428.49 g/mol
SMILES N#C/C(=C\c1ccc(o1)c1nc2c(n1C1CCCCC1)c1cc[nH]c1nc2)/C(=O)N(C)C
InChIKey QGZKDVFQNNGYKY-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What industries use (2E)-2-Cyano-3-[5-(1-cyclohexyl-1,6-dihydroimidazo[4,5-d]pyrrolo[2,3-b]pyridin-2-yl)-2-furyl]-N,N-dimethylacrylamide (CAS: 2226521-65-7)?

This compound is primarily used in the pharmaceutical industry for its potential as an intermediate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...