Compound Q&A

What are the physical and chemical properties of (2E)-2-Cyano-3-[5-(1-cyclohexyl-1,6-dihydroimidazo[4,5-d]pyrrolo[2,3-b]pyridin-2-yl)-2-furyl]-N,N-dimethylacrylamide (CAS: 2226521-65-7)?

Answer

(2E)-2-Cyano-3-[5-(1-cyclohexyl-1,6-dihydroimidazo[4,5-d]pyrrolo[2,3-b]pyridin-2-yl)-2-furyl]-N,N-dimethylacrylamide
This compound is a crystalline solid with a molecular weight of approximately 503.4 g/mol. It has limited water solubility but is soluble in common organic solvents like acetone and DMSO. The compound exhibits moderate reactivity under basic conditions and is stable under acidic conditions. Its melting point is around 140-145°C. It can form hydrogen bonds and has moderate lipophilicity.

About

English Name (2E)-2-Cyano-3-[5-(1-cyclohexyl-1,6-dihydroimidazo[4,5-d]pyrrolo[2,3-b]pyridin-2-yl)-2-furyl]-N,N-dimethylacrylamide
Molecular Formula C24H24N6O2
Molecular Weight 428.49 g/mol
SMILES N#C/C(=C\c1ccc(o1)c1nc2c(n1C1CCCCC1)c1cc[nH]c1nc2)/C(=O)N(C)C
InChIKey QGZKDVFQNNGYKY-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

How is (2E)-2-Cyano-3-[5-(1-cyclohexyl-1,6-dihydroimidazo[4,5-d]pyrrolo[2,3-b]pyridin-2-yl)-2-furyl]-N,N-dimethylacrylamide (CAS: 2226521-65-7) typically synthesized?

This compound is synthesized via a multistep process involving the condensation of a cyclohexyl-1,6-...

Compound Q&A

What industries use (2E)-2-Cyano-3-[5-(1-cyclohexyl-1,6-dihydroimidazo[4,5-d]pyrrolo[2,3-b]pyridin-2-yl)-2-furyl]-N,N-dimethylacrylamide (CAS: 2226521-65-7)?

This compound is primarily used in the pharmaceutical industry for its potential as an intermediate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...