Compound Q&A

What precautions should be taken when handling Atorvastatin Epoxy Tetrahydrofuran Impurity (CAS: 873950-19-7)?

Answer

Atorvastatin Epoxy Tetrahydrofuran Impurity
When handling Atorvastatin Epoxy Tetrahydrofuran Impurity, it is essential to wear appropriate personal protective equipment (PPE) such as gloves and safety glasses. Work should be conducted in a well-ventilated area or a fume hood to minimize inhalation risk. Spills should be cleaned up using appropriate absorbent materials, and the area should be thoroughly cleaned. Always refer to the safety data sheet (SDS) for detailed information on handling and emergency procedures.

About

English Name Atorvastatin Epoxy Tetrahydrofuran Impurity
Molecular Formula C26H24FNO5
Molecular Weight 449.48 g/mol
SMILES CC(C)C1(O)OC(O)(C2=CC=C(F)C=C2)C2(OC12C(=O)NC1=CC=CC=C1)C1=CC=CC=C1
InChIKey NNEBPPHOMFPLDK-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Atorvastatin Epoxy Tetrahydrofuran Impurity (CAS: 873950-19-7)?

Atorvastatin Epoxy Tetrahydrofuran Impurity is a white to off-white crystalline solid with a molecul...

Compound Q&A

How is Atorvastatin Epoxy Tetrahydrofuran Impurity (CAS: 873950-19-7) typically synthesized?

Atorvastatin Epoxy Tetrahydrofuran Impurity is typically synthesized through a series of stereoselec...

Compound Q&A

What industries use Atorvastatin Epoxy Tetrahydrofuran Impurity (CAS: 873950-19-7)?

Atorvastatin Epoxy Tetrahydrofuran Impurity is used primarily in the pharmaceutical industry as an i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...