Compound Q&A

How is Atorvastatin Epoxy Tetrahydrofuran Impurity (CAS: 873950-19-7) typically synthesized?

Answer

Atorvastatin Epoxy Tetrahydrofuran Impurity
Atorvastatin Epoxy Tetrahydrofuran Impurity is typically synthesized through a series of stereoselective reactions, including epoxidation and cyclization steps. Common catalysts used in the synthesis include metal complexes and organocatalysts. The overall yield is around 50-60%, and the process involves careful monitoring of reaction conditions to ensure high selectivity and purity.

About

English Name Atorvastatin Epoxy Tetrahydrofuran Impurity
Molecular Formula C26H24FNO5
Molecular Weight 449.48 g/mol
SMILES CC(C)C1(O)OC(O)(C2=CC=C(F)C=C2)C2(OC12C(=O)NC1=CC=CC=C1)C1=CC=CC=C1
InChIKey NNEBPPHOMFPLDK-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Atorvastatin Epoxy Tetrahydrofuran Impurity (CAS: 873950-19-7)?

Atorvastatin Epoxy Tetrahydrofuran Impurity is a white to off-white crystalline solid with a molecul...

Compound Q&A

What industries use Atorvastatin Epoxy Tetrahydrofuran Impurity (CAS: 873950-19-7)?

Atorvastatin Epoxy Tetrahydrofuran Impurity is used primarily in the pharmaceutical industry as an i...

Compound Q&A

What precautions should be taken when handling Atorvastatin Epoxy Tetrahydrofuran Impurity (CAS: 873950-19-7)?

When handling Atorvastatin Epoxy Tetrahydrofuran Impurity, it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...