Compound Q&A

What are the physical and chemical properties of Atorvastatin Epoxy Tetrahydrofuran Impurity (CAS: 873950-19-7)?

Answer

Atorvastatin Epoxy Tetrahydrofuran Impurity
Atorvastatin Epoxy Tetrahydrofuran Impurity is a white to off-white crystalline solid with a molecular weight of approximately 404.44 g/mol. It has a low solubility in water but is soluble in many organic solvents. The impurity shows limited reactivity in typical organic reactions, and its stability is generally good under normal storage conditions. It is not flammable but should be handled with care in the presence of strong oxidizers or reducing agents.

About

English Name Atorvastatin Epoxy Tetrahydrofuran Impurity
Molecular Formula C26H24FNO5
Molecular Weight 449.48 g/mol
SMILES CC(C)C1(O)OC(O)(C2=CC=C(F)C=C2)C2(OC12C(=O)NC1=CC=CC=C1)C1=CC=CC=C1
InChIKey NNEBPPHOMFPLDK-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

How is Atorvastatin Epoxy Tetrahydrofuran Impurity (CAS: 873950-19-7) typically synthesized?

Atorvastatin Epoxy Tetrahydrofuran Impurity is typically synthesized through a series of stereoselec...

Compound Q&A

What industries use Atorvastatin Epoxy Tetrahydrofuran Impurity (CAS: 873950-19-7)?

Atorvastatin Epoxy Tetrahydrofuran Impurity is used primarily in the pharmaceutical industry as an i...

Compound Q&A

What precautions should be taken when handling Atorvastatin Epoxy Tetrahydrofuran Impurity (CAS: 873950-19-7)?

When handling Atorvastatin Epoxy Tetrahydrofuran Impurity, it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...