Compound Q&A

What industries use Atorvastatin Epoxy Tetrahydrofuran Impurity (CAS: 873950-19-7)?

Answer

Atorvastatin Epoxy Tetrahydrofuran Impurity
Atorvastatin Epoxy Tetrahydrofuran Impurity is used primarily in the pharmaceutical industry as an impurity in the production of atorvastatin, a cholesterol-lowering drug. It may also find limited use in research and development for studies on lipid metabolism and related pathways.

About

English Name Atorvastatin Epoxy Tetrahydrofuran Impurity
Molecular Formula C26H24FNO5
Molecular Weight 449.48 g/mol
SMILES CC(C)C1(O)OC(O)(C2=CC=C(F)C=C2)C2(OC12C(=O)NC1=CC=CC=C1)C1=CC=CC=C1
InChIKey NNEBPPHOMFPLDK-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Atorvastatin Epoxy Tetrahydrofuran Impurity (CAS: 873950-19-7)?

Atorvastatin Epoxy Tetrahydrofuran Impurity is a white to off-white crystalline solid with a molecul...

Compound Q&A

How is Atorvastatin Epoxy Tetrahydrofuran Impurity (CAS: 873950-19-7) typically synthesized?

Atorvastatin Epoxy Tetrahydrofuran Impurity is typically synthesized through a series of stereoselec...

Compound Q&A

What precautions should be taken when handling Atorvastatin Epoxy Tetrahydrofuran Impurity (CAS: 873950-19-7)?

When handling Atorvastatin Epoxy Tetrahydrofuran Impurity, it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...