Compound Q&A

What precautions should be taken when handling ciprofloxacin-d8 hydrochloride (CAS: 1216659-54-9)?

Answer

Ciprofloxacin-d8, Hydrochloride
When handling ciprofloxacin-d8 hydrochloride, appropriate personal protective equipment (PPE) such as gloves, goggles, and lab coat should be worn. Work should be conducted in a well-ventilated area or fume hood. Spills should be cleaned up immediately using appropriate absorbents and the area should be neutralized according to the Safety Data Sheet (SDS).

About

English Name Ciprofloxacin-d8, Hydrochloride
Molecular Formula C17H11D8ClFN3O3
Molecular Weight 375.86 g/mol
SMILES C1CC1N2C=C(C(=O)C3=CC(=C(C=C32)N4CCNCC4)F)C(=O)O.Cl
InChIKey DIOIOSKKIYDRIQ-JCYLEXHWSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ciprofloxacin-d8 hydrochloride (CAS: 1216659-54-9)?

Ciprofloxacin-d8 hydrochloride is a crystalline compound with a molecular weight of approximately 62...

Compound Q&A

How is ciprofloxacin-d8 hydrochloride (CAS: 1216659-54-9) typically synthesized?

Ciprofloxacin-d8 hydrochloride is typically synthesized by alkylation of the amine group of ciproflo...

Compound Q&A

What industries use ciprofloxacin-d8 hydrochloride (CAS: 1216659-54-9)?

Ciprofloxacin-d8 hydrochloride is primarily used in the pharmaceutical industry for the synthesis of...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...