Compound Q&A

How is ciprofloxacin-d8 hydrochloride (CAS: 1216659-54-9) typically synthesized?

Answer

Ciprofloxacin-d8, Hydrochloride
Ciprofloxacin-d8 hydrochloride is typically synthesized by alkylation of the amine group of ciprofloxacin with deuterated alkyl halide, followed by addition of hydrochloric acid. The reaction is catalyzed by a phase-transfer catalyst, and the product is obtained with good yield and selectivity.

About

English Name Ciprofloxacin-d8, Hydrochloride
Molecular Formula C17H11D8ClFN3O3
Molecular Weight 375.85681422400006 g/mol
SMILES C1CC1N2C=C(C(=O)C3=CC(=C(C=C32)N4CCNCC4)F)C(=O)O.Cl
InChIKey DIOIOSKKIYDRIQ-JCYLEXHWSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ciprofloxacin-d8 hydrochloride (CAS: 1216659-54-9)?

Ciprofloxacin-d8 hydrochloride is a crystalline compound with a molecular weight of approximately 62...

Compound Q&A

What industries use ciprofloxacin-d8 hydrochloride (CAS: 1216659-54-9)?

Ciprofloxacin-d8 hydrochloride is primarily used in the pharmaceutical industry for the synthesis of...

Compound Q&A

What precautions should be taken when handling ciprofloxacin-d8 hydrochloride (CAS: 1216659-54-9)?

When handling ciprofloxacin-d8 hydrochloride, appropriate personal protective equipment (PPE) such a...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...