Compound Q&A

What industries use ciprofloxacin-d8 hydrochloride (CAS: 1216659-54-9)?

Answer

Ciprofloxacin-d8, Hydrochloride
Ciprofloxacin-d8 hydrochloride is primarily used in the pharmaceutical industry for the synthesis of deuterium-labeled ciprofloxacin for drug metabolism studies. It is also used in research for its enhanced stability and improved labeling efficiency.

About

English Name Ciprofloxacin-d8, Hydrochloride
Molecular Formula C17H11D8ClFN3O3
Molecular Weight 375.86 g/mol
SMILES C1CC1N2C=C(C(=O)C3=CC(=C(C=C32)N4CCNCC4)F)C(=O)O.Cl
InChIKey DIOIOSKKIYDRIQ-JCYLEXHWSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ciprofloxacin-d8 hydrochloride (CAS: 1216659-54-9)?

Ciprofloxacin-d8 hydrochloride is a crystalline compound with a molecular weight of approximately 62...

Compound Q&A

How is ciprofloxacin-d8 hydrochloride (CAS: 1216659-54-9) typically synthesized?

Ciprofloxacin-d8 hydrochloride is typically synthesized by alkylation of the amine group of ciproflo...

Compound Q&A

What precautions should be taken when handling ciprofloxacin-d8 hydrochloride (CAS: 1216659-54-9)?

When handling ciprofloxacin-d8 hydrochloride, appropriate personal protective equipment (PPE) such a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...