Compound Q&A

What precautions should be taken when handling (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid (CAS: 865352-21-2)?

Answer

(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid
Precautions when handling (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid include the use of personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be conducted in a well-ventilated area or fume hood to minimize inhalation exposure. Spills should be cleaned up with care using appropriate absorbents, and the area should be thoroughly washed down. Consult the Safety Data Sheet (SDS) for specific hazard information and safety guidelines.

About

English Name (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid
Molecular Formula C21H21NO4
Molecular Weight 351.4 g/mol
SMILES C=CCC[C@@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C(O)=O
InChIKey CPJQXKHZCVDRSX-LJQANCHMSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid (CAS: 865352-21-2)?

(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid is a white to off-white crystalline sol...

Compound Q&A

How is (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid (CAS: 865352-21-2) typically synthesized?

(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid is typically synthesized through multis...

Compound Q&A

What industries use (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid (CAS: 865352-21-2)?

(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid is primarily used in the pharmaceutical...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...