Compound Q&A

What industries use (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid (CAS: 865352-21-2)?

Answer

(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid is primarily used in the pharmaceutical industry for the synthesis of complex molecules and in the development of new drug candidates. It is also utilized in the polymer industry for the modification of polymer properties, and in the sensor industry for the creation of sensitive detection devices. Its unique chemical structure makes it valuable in these applications.

About

English Name (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid
Molecular Formula C21H21NO4
Molecular Weight 351.4020000000001 g/mol
SMILES C=CCC[C@@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C(O)=O
InChIKey CPJQXKHZCVDRSX-LJQANCHMSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid (CAS: 865352-21-2)?

(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid is a white to off-white crystalline sol...

Compound Q&A

How is (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid (CAS: 865352-21-2) typically synthesized?

(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid is typically synthesized through multis...

Compound Q&A

What precautions should be taken when handling (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid (CAS: 865352-21-2)?

Precautions when handling (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid include the u...

Compound Q&A

What industries use (1R,3S)-1,3-Cyclopentanediol (CAS: 16326-97-9)?

(1R,3S)-1,3-Cyclopentanediol finds applications in various industries. In the ph...

16326-97-9(1R,3S)-1,3-Cyclopen...
Compound Q&A

What precautions should be taken when handling N'-[4-(Dimethylamino)phenyl]-N,N-dimethyl-1,4-benzenediamine (CAS: 637-31-0)?

When handling N'-[4-(Dimethylamino)phenyl]-N,N-dimethyl-1,4-benzenediamine, it i...

637-31-0N'-[4-(Dimethylamino...
Compound Q&A

Are there alternatives to 5-(2,4-Difluorophenyl)-2-methoxypyrimidine (CAS: 1352318-16-1) in synthesis?

There are several alternatives to 5-(2,4-Difluorophenyl)-2-methoxypyrimidine in ...

1352318-16-15-(2,4-Difluoropheny...
Compound Q&A

What regulatory guidelines apply to 1-(3-Methoxyphenoxy)propan-2-ol (CAS: 382141-68-6)?

1-(3-Methoxyphenoxy)propan-2-ol (CAS: 382141-68-6) must comply with the Globally...

382141-68-61-(3-Methoxyphenoxy)...