Compound Q&A

What are the physical and chemical properties of (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid (CAS: 865352-21-2)?

Answer

(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid is a white to off-white crystalline solid with a molecular weight of approximately 398.39 g/mol. It has a moderate solubility in common organic solvents like methanol and ethanol, but is poorly soluble in water. The compound is chemically reactive, particularly towards nucleophiles, and exhibits ester and amide functional groups typical of its structure.

About

English Name (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid
Molecular Formula C21H21NO4
Molecular Weight 351.4020000000001 g/mol
SMILES C=CCC[C@@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C(O)=O
InChIKey CPJQXKHZCVDRSX-LJQANCHMSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

How is (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid (CAS: 865352-21-2) typically synthesized?

(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid is typically synthesized through multis...

Compound Q&A

What industries use (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid (CAS: 865352-21-2)?

(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid is primarily used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid (CAS: 865352-21-2)?

Precautions when handling (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hex-5-enoic acid include the u...

Compound Q&A

What industries use (1R,3S)-1,3-Cyclopentanediol (CAS: 16326-97-9)?

(1R,3S)-1,3-Cyclopentanediol finds applications in various industries. In the ph...

16326-97-9(1R,3S)-1,3-Cyclopen...
Compound Q&A

What precautions should be taken when handling N'-[4-(Dimethylamino)phenyl]-N,N-dimethyl-1,4-benzenediamine (CAS: 637-31-0)?

When handling N'-[4-(Dimethylamino)phenyl]-N,N-dimethyl-1,4-benzenediamine, it i...

637-31-0N'-[4-(Dimethylamino...
Compound Q&A

Are there alternatives to 5-(2,4-Difluorophenyl)-2-methoxypyrimidine (CAS: 1352318-16-1) in synthesis?

There are several alternatives to 5-(2,4-Difluorophenyl)-2-methoxypyrimidine in ...

1352318-16-15-(2,4-Difluoropheny...
Compound Q&A

What regulatory guidelines apply to 1-(3-Methoxyphenoxy)propan-2-ol (CAS: 382141-68-6)?

1-(3-Methoxyphenoxy)propan-2-ol (CAS: 382141-68-6) must comply with the Globally...

382141-68-61-(3-Methoxyphenoxy)...