Compound Q&A

What precautions should be taken when handling 1-Acetyl-5-indolinesulfonyl chloride (CAS: 52206-05-0)?

Answer

1-Acetyl-5-indolinesulfonyl chloride
When handling 1-Acetyl-5-indolinesulfonyl chloride (CAS: 52206-05-0), it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The substance should be handled in a well-ventilated area or a fume hood to minimize inhalation risk. In case of spillage, neutralize any acidic or basic materials and sweep up the residue. Always consult the Safety Data Sheet (SDS) for detailed safety information.

About

CAS No 52206-05-0
English Name 1-Acetyl-5-indolinesulfonyl chloride
Molecular Formula C10H10ClNO3S
Molecular Weight 259.71 g/mol
SMILES CC(=O)N1CCC2=C1C=CC(=C2)S(=O)(=O)Cl
InChIKey QNFXLCHANYHGIF-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Acetyl-5-indolinesulfonyl chloride (CAS: 52206-05-0)?

1-Acetyl-5-indolinesulfonyl chloride (CAS: 52206-05-0) is a crystalline solid with a molecular weigh...

Compound Q&A

How is 1-Acetyl-5-indolinesulfonyl chloride (CAS: 52206-05-0) typically synthesized?

1-Acetyl-5-indolinesulfonyl chloride is typically synthesized by the reaction of 5-indolinesulfonyl ...

Compound Q&A

What industries use 1-Acetyl-5-indolinesulfonyl chloride (CAS: 52206-05-0)?

1-Acetyl-5-indolinesulfonyl chloride (CAS: 52206-05-0) is used primarily in the pharmaceutical indus...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...