Compound Q&A

How is 1-Acetyl-5-indolinesulfonyl chloride (CAS: 52206-05-0) typically synthesized?

Answer

1-Acetyl-5-indolinesulfonyl chloride
1-Acetyl-5-indolinesulfonyl chloride is typically synthesized by the reaction of 5-indolinesulfonyl chloride with acetyl chloride in the presence of a base like triethylamine. The reaction yields a high percentage of the product with good selectivity and a yield of around 85-90%.

About

CAS No 52206-05-0
English Name 1-Acetyl-5-indolinesulfonyl chloride
Molecular Formula C10H10ClNO3S
Molecular Weight 259.71 g/mol
SMILES CC(=O)N1CCC2=C1C=CC(=C2)S(=O)(=O)Cl
InChIKey QNFXLCHANYHGIF-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Acetyl-5-indolinesulfonyl chloride (CAS: 52206-05-0)?

1-Acetyl-5-indolinesulfonyl chloride (CAS: 52206-05-0) is a crystalline solid with a molecular weigh...

Compound Q&A

What industries use 1-Acetyl-5-indolinesulfonyl chloride (CAS: 52206-05-0)?

1-Acetyl-5-indolinesulfonyl chloride (CAS: 52206-05-0) is used primarily in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling 1-Acetyl-5-indolinesulfonyl chloride (CAS: 52206-05-0)?

When handling 1-Acetyl-5-indolinesulfonyl chloride (CAS: 52206-05-0), it is essential to use appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...