Compound Q&A

What industries use 1-Acetyl-5-indolinesulfonyl chloride (CAS: 52206-05-0)?

Answer

1-Acetyl-5-indolinesulfonyl chloride
1-Acetyl-5-indolinesulfonyl chloride (CAS: 52206-05-0) is used primarily in the pharmaceutical industry for the synthesis of drugs. It is also utilized in the polymer industry for the preparation of functional polymers and in the semiconductor industry for the production of organic electronic materials.

About

CAS No 52206-05-0
English Name 1-Acetyl-5-indolinesulfonyl chloride
Molecular Formula C10H10ClNO3S
Molecular Weight 259.71 g/mol
SMILES CC(=O)N1CCC2=C1C=CC(=C2)S(=O)(=O)Cl
InChIKey QNFXLCHANYHGIF-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Acetyl-5-indolinesulfonyl chloride (CAS: 52206-05-0)?

1-Acetyl-5-indolinesulfonyl chloride (CAS: 52206-05-0) is a crystalline solid with a molecular weigh...

Compound Q&A

How is 1-Acetyl-5-indolinesulfonyl chloride (CAS: 52206-05-0) typically synthesized?

1-Acetyl-5-indolinesulfonyl chloride is typically synthesized by the reaction of 5-indolinesulfonyl ...

Compound Q&A

What precautions should be taken when handling 1-Acetyl-5-indolinesulfonyl chloride (CAS: 52206-05-0)?

When handling 1-Acetyl-5-indolinesulfonyl chloride (CAS: 52206-05-0), it is essential to use appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...