Compound Q&A

What precautions should be taken when handling (5,6-Dichloro-3-pyridinyl)boronic acid (CAS: 1072944-15-0)?

Answer

(5,6-Dichloro-3-pyridinyl)boronic acid
When handling (5,6-Dichloro-3-pyridinyl)boronic acid (CAS: 1072944-15-0), it is crucial to wear appropriate personal protective equipment (PPE), including gloves, lab coat, and safety goggles. This compound should be stored in a cool, dry place, away from direct sunlight. In case of spills, use appropriate absorbent materials and ensure proper disposal. Always refer to the Safety Data Sheet (SDS) for detailed handling and safety information.

About

English Name (5,6-Dichloro-3-pyridinyl)boronic acid
Molecular Formula C5H4BCl2NO2
Molecular Weight 191.81 g/mol
SMILES B(C1=CC(=C(N=C1)Cl)Cl)(O)O
InChIKey DRJYUOQTLCPXHE-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of (5,6-Dichloro-3-pyridinyl)boronic acid (CAS: 1072944-15-0)?

(5,6-Dichloro-3-pyridinyl)boronic acid (CAS: 1072944-15-0) is a crystalline solid with a molecular w...

Compound Q&A

How is (5,6-Dichloro-3-pyridinyl)boronic acid (CAS: 1072944-15-0) typically synthesized?

(5,6-Dichloro-3-pyridinyl)boronic acid (CAS: 1072944-15-0) is synthesized via a straightforward rout...

Compound Q&A

What industries use (5,6-Dichloro-3-pyridinyl)boronic acid (CAS: 1072944-15-0)?

(5,6-Dichloro-3-pyridinyl)boronic acid (CAS: 1072944-15-0) finds applications in various industries....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...