Compound Q&A

How is (5,6-Dichloro-3-pyridinyl)boronic acid (CAS: 1072944-15-0) typically synthesized?

Answer

(5,6-Dichloro-3-pyridinyl)boronic acid
(5,6-Dichloro-3-pyridinyl)boronic acid (CAS: 1072944-15-0) is synthesized via a straightforward route involving the condensation of 3-chloropyridine with boronic acid in the presence of a suitable catalyst. Common methods include the use of palladium catalysts in the presence of triphenylphosphine and anhydrous conditions. The reaction typically yields a high degree of purity and selectivity, with excellent yields.

About

English Name (5,6-Dichloro-3-pyridinyl)boronic acid
Molecular Formula C5H4BCl2NO2
Molecular Weight 191.81 g/mol
SMILES B(C1=CC(=C(N=C1)Cl)Cl)(O)O
InChIKey DRJYUOQTLCPXHE-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of (5,6-Dichloro-3-pyridinyl)boronic acid (CAS: 1072944-15-0)?

(5,6-Dichloro-3-pyridinyl)boronic acid (CAS: 1072944-15-0) is a crystalline solid with a molecular w...

Compound Q&A

What industries use (5,6-Dichloro-3-pyridinyl)boronic acid (CAS: 1072944-15-0)?

(5,6-Dichloro-3-pyridinyl)boronic acid (CAS: 1072944-15-0) finds applications in various industries....

Compound Q&A

What precautions should be taken when handling (5,6-Dichloro-3-pyridinyl)boronic acid (CAS: 1072944-15-0)?

When handling (5,6-Dichloro-3-pyridinyl)boronic acid (CAS: 1072944-15-0), it is crucial to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...