Compound Q&A

What are the physical and chemical properties of (5,6-Dichloro-3-pyridinyl)boronic acid (CAS: 1072944-15-0)?

Answer

(5,6-Dichloro-3-pyridinyl)boronic acid
(5,6-Dichloro-3-pyridinyl)boronic acid (CAS: 1072944-15-0) is a crystalline solid with a molecular weight of approximately 225.04 g/mol. This compound has a solubility of about 1.5 g/L in water and is moderately soluble in common organic solvents. It exhibits moderate reactivity, particularly in nucleophilic addition and substitution reactions. This boronic acid is known for its use in organic synthesis and catalysis.

About

English Name (5,6-Dichloro-3-pyridinyl)boronic acid
Molecular Formula C5H4BCl2NO2
Molecular Weight 191.81 g/mol
SMILES B(C1=CC(=C(N=C1)Cl)Cl)(O)O
InChIKey DRJYUOQTLCPXHE-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

How is (5,6-Dichloro-3-pyridinyl)boronic acid (CAS: 1072944-15-0) typically synthesized?

(5,6-Dichloro-3-pyridinyl)boronic acid (CAS: 1072944-15-0) is synthesized via a straightforward rout...

Compound Q&A

What industries use (5,6-Dichloro-3-pyridinyl)boronic acid (CAS: 1072944-15-0)?

(5,6-Dichloro-3-pyridinyl)boronic acid (CAS: 1072944-15-0) finds applications in various industries....

Compound Q&A

What precautions should be taken when handling (5,6-Dichloro-3-pyridinyl)boronic acid (CAS: 1072944-15-0)?

When handling (5,6-Dichloro-3-pyridinyl)boronic acid (CAS: 1072944-15-0), it is crucial to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...