Compound Q&A

What precautions should be taken when handling Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4)?

Answer

Ethyl 3-amino-5-chloro-2-pyridinecarboxylate
When handling Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Use a fume hood to minimize exposure to vapors. Spills should be carefully cleaned up using absorbent materials, and the area should be ventilated. Always consult the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

CAS No 27330-35-4
English Name Ethyl 3-amino-5-chloro-2-pyridinecarboxylate
Molecular Formula C8H9ClN2O2
Molecular Weight 200.63 g/mol
SMILES CCOC(=O)C1=C(C=C(C=N1)Cl)N
InChIKey KYZPCGKVPOZMIB-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4)?

Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4) is a crystalline compound with a mole...

Compound Q&A

How is Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4) typically synthesized?

Ethyl 3-amino-5-chloro-2-pyridinecarboxylate is typically synthesized via the reaction of 5-chloro-2...

Compound Q&A

What industries use Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4)?

Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4) is primarily used in the pharmaceutic...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...