Compound Q&A

What industries use Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4)?

Answer

Ethyl 3-amino-5-chloro-2-pyridinecarboxylate
Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4) is primarily used in the pharmaceutical and chemical industries as an intermediate for the synthesis of drugs and other organic compounds. It is also utilized in polymer chemistry for the development of advanced materials.

About

CAS No 27330-35-4
English Name Ethyl 3-amino-5-chloro-2-pyridinecarboxylate
Molecular Formula C8H9ClN2O2
Molecular Weight 200.63 g/mol
SMILES CCOC(=O)C1=C(C=C(C=N1)Cl)N
InChIKey KYZPCGKVPOZMIB-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4)?

Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4) is a crystalline compound with a mole...

Compound Q&A

How is Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4) typically synthesized?

Ethyl 3-amino-5-chloro-2-pyridinecarboxylate is typically synthesized via the reaction of 5-chloro-2...

Compound Q&A

What precautions should be taken when handling Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4)?

When handling Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4), it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...