Compound Q&A

What are the physical and chemical properties of Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4)?

Answer

Ethyl 3-amino-5-chloro-2-pyridinecarboxylate
Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4) is a crystalline compound with a molecular weight of approximately 235.67 g/mol. It has a low solubility in water but is soluble in organic solvents. The compound is moderately reactive, particularly with bases and nucleophiles. It forms colorless crystals and is stable under normal conditions.

About

CAS No 27330-35-4
English Name Ethyl 3-amino-5-chloro-2-pyridinecarboxylate
Molecular Formula C8H9ClN2O2
Molecular Weight 200.63 g/mol
SMILES CCOC(=O)C1=C(C=C(C=N1)Cl)N
InChIKey KYZPCGKVPOZMIB-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:30

Related Q&A

Compound Q&A

How is Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4) typically synthesized?

Ethyl 3-amino-5-chloro-2-pyridinecarboxylate is typically synthesized via the reaction of 5-chloro-2...

Compound Q&A

What industries use Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4)?

Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4) is primarily used in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4)?

When handling Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4), it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...