Compound Q&A

How is Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4) typically synthesized?

Answer

Ethyl 3-amino-5-chloro-2-pyridinecarboxylate
Ethyl 3-amino-5-chloro-2-pyridinecarboxylate is typically synthesized via the reaction of 5-chloro-2-pyridinecarboxylic acid with ethylamine in the presence of a base like triethylamine. The reaction yields the desired amino compound with good selectivity and high yield. This method is commonly used in the synthesis of pharmaceutical intermediates.

About

CAS No 27330-35-4
English Name Ethyl 3-amino-5-chloro-2-pyridinecarboxylate
Molecular Formula C8H9ClN2O2
Molecular Weight 200.63 g/mol
SMILES CCOC(=O)C1=C(C=C(C=N1)Cl)N
InChIKey KYZPCGKVPOZMIB-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4)?

Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4) is a crystalline compound with a mole...

Compound Q&A

What industries use Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4)?

Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4) is primarily used in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4)?

When handling Ethyl 3-amino-5-chloro-2-pyridinecarboxylate (CAS: 27330-35-4), it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...