Compound Q&A

What precautions should be taken when handling (1-Chloro-4-isoquinolinyl)boronic acid (CAS: 848841-48-5)?

Answer

(1-Chloro-4-isoquinolinyl)boronic acid
When handling (1-Chloro-4-isoquinolinyl)boronic acid, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood to avoid inhalation of the compound. In case of spills, immediately clean up using appropriate absorbents and dispose of according to local regulations. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information and emergency procedures.

About

English Name (1-Chloro-4-isoquinolinyl)boronic acid
Molecular Formula C9H7BClNO2
Molecular Weight 207.43 g/mol
SMILES B(C1=CN=C(C2=CC=CC=C12)Cl)(O)O
InChIKey LIQWKDFYRGYBQH-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1-Chloro-4-isoquinolinyl)boronic acid (CAS: 848841-48-5)?

(1-Chloro-4-isoquinolinyl)boronic acid is a white crystalline solid with a molecular weight of appro...

Compound Q&A

How is (1-Chloro-4-isoquinolinyl)boronic acid (CAS: 848841-48-5) typically synthesized?

(1-Chloro-4-isoquinolinyl)boronic acid is typically synthesized via the reaction of 1-chloro-4-isoqu...

Compound Q&A

What industries use (1-Chloro-4-isoquinolinyl)boronic acid (CAS: 848841-48-5)?

(1-Chloro-4-isoquinolinyl)boronic acid finds applications in the pharmaceutical industry for the syn...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...