Compound Q&A

How is (1-Chloro-4-isoquinolinyl)boronic acid (CAS: 848841-48-5) typically synthesized?

Answer

(1-Chloro-4-isoquinolinyl)boronic acid
(1-Chloro-4-isoquinolinyl)boronic acid is typically synthesized via the reaction of 1-chloro-4-isoquinoline with boronic anilide under basic conditions. The process involves the use of sodium carbonate or potassium carbonate as a base and often requires mild heating. The yield is generally good, and the method is known for its high selectivity and reproducibility.

About

English Name (1-Chloro-4-isoquinolinyl)boronic acid
Molecular Formula C9H7BClNO2
Molecular Weight 207.43 g/mol
SMILES B(C1=CN=C(C2=CC=CC=C12)Cl)(O)O
InChIKey LIQWKDFYRGYBQH-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1-Chloro-4-isoquinolinyl)boronic acid (CAS: 848841-48-5)?

(1-Chloro-4-isoquinolinyl)boronic acid is a white crystalline solid with a molecular weight of appro...

Compound Q&A

What industries use (1-Chloro-4-isoquinolinyl)boronic acid (CAS: 848841-48-5)?

(1-Chloro-4-isoquinolinyl)boronic acid finds applications in the pharmaceutical industry for the syn...

Compound Q&A

What precautions should be taken when handling (1-Chloro-4-isoquinolinyl)boronic acid (CAS: 848841-48-5)?

When handling (1-Chloro-4-isoquinolinyl)boronic acid, it is essential to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...