Compound Q&A

What are the physical and chemical properties of (1-Chloro-4-isoquinolinyl)boronic acid (CAS: 848841-48-5)?

Answer

(1-Chloro-4-isoquinolinyl)boronic acid
(1-Chloro-4-isoquinolinyl)boronic acid is a white crystalline solid with a molecular weight of approximately 273.07 g/mol. It is slightly soluble in water and ethanol. The compound is moderately reactive, particularly in its ability to form boronate esters. It is known for its high reactivity with phenols and its use in various synthetic applications.

About

English Name (1-Chloro-4-isoquinolinyl)boronic acid
Molecular Formula C9H7BClNO2
Molecular Weight 207.43 g/mol
SMILES B(C1=CN=C(C2=CC=CC=C12)Cl)(O)O
InChIKey LIQWKDFYRGYBQH-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

How is (1-Chloro-4-isoquinolinyl)boronic acid (CAS: 848841-48-5) typically synthesized?

(1-Chloro-4-isoquinolinyl)boronic acid is typically synthesized via the reaction of 1-chloro-4-isoqu...

Compound Q&A

What industries use (1-Chloro-4-isoquinolinyl)boronic acid (CAS: 848841-48-5)?

(1-Chloro-4-isoquinolinyl)boronic acid finds applications in the pharmaceutical industry for the syn...

Compound Q&A

What precautions should be taken when handling (1-Chloro-4-isoquinolinyl)boronic acid (CAS: 848841-48-5)?

When handling (1-Chloro-4-isoquinolinyl)boronic acid, it is essential to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...