Compound Q&A

What industries use (1-Chloro-4-isoquinolinyl)boronic acid (CAS: 848841-48-5)?

Answer

(1-Chloro-4-isoquinolinyl)boronic acid
(1-Chloro-4-isoquinolinyl)boronic acid finds applications in the pharmaceutical industry for the synthesis of drug intermediates, particularly those involved in chemotherapy. It is also used in the polymer industry for the modification of polymers and in the development of sensors due to its reactivity and functional group availability. Additionally, it has potential use in semiconductor applications for specific chemical modification processes.

About

English Name (1-Chloro-4-isoquinolinyl)boronic acid
Molecular Formula C9H7BClNO2
Molecular Weight 207.43 g/mol
SMILES B(C1=CN=C(C2=CC=CC=C12)Cl)(O)O
InChIKey LIQWKDFYRGYBQH-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1-Chloro-4-isoquinolinyl)boronic acid (CAS: 848841-48-5)?

(1-Chloro-4-isoquinolinyl)boronic acid is a white crystalline solid with a molecular weight of appro...

Compound Q&A

How is (1-Chloro-4-isoquinolinyl)boronic acid (CAS: 848841-48-5) typically synthesized?

(1-Chloro-4-isoquinolinyl)boronic acid is typically synthesized via the reaction of 1-chloro-4-isoqu...

Compound Q&A

What precautions should be taken when handling (1-Chloro-4-isoquinolinyl)boronic acid (CAS: 848841-48-5)?

When handling (1-Chloro-4-isoquinolinyl)boronic acid, it is essential to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...