Compound Q&A

What industries use 1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine (CAS: 340041-91-0)?

Answer

1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine
1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine is primarily used in the pharmaceutical industry as an intermediate for the synthesis of various drugs. It is also utilized in the polymer industry for the preparation of functional polymers with improved properties. Additionally, it finds applications in the development of sensors and semiconductors.

About

English Name 1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine
Molecular Formula C11H14N2O4S
Molecular Weight 270.31 g/mol
SMILES C1CCN(C1)S(=O)(=O)CC2=CC=C(C=C2)[N+](=O)[O-]
InChIKey RCEYIHLMZBWOJK-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine (CAS: 340041-91-0)?

1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine is a crystalline compound with a molecular weight of approxim...

Compound Q&A

How is 1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine (CAS: 340041-91-0) typically synthesized?

1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine is typically synthesized through the condensation of 4-nitrob...

Compound Q&A

What precautions should be taken when handling 1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine (CAS: 340041-91-0)?

When handling 1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine (CAS: 340041-91-0), it is important to use pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...