Compound Q&A

How is 1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine (CAS: 340041-91-0) typically synthesized?

Answer

1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine
1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine is typically synthesized through the condensation of 4-nitrobenzyl bromide with pyrrolidine in the presence of a base such as potassium carbonate. The reaction is performed in an aprotic solvent like N,N-dimethylformamide (DMF) at room temperature. The yield can reach up to 85% with selectivity towards the desired product.

About

English Name 1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine
Molecular Formula C11H14N2O4S
Molecular Weight 270.31 g/mol
SMILES C1CCN(C1)S(=O)(=O)CC2=CC=C(C=C2)[N+](=O)[O-]
InChIKey RCEYIHLMZBWOJK-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine (CAS: 340041-91-0)?

1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine is a crystalline compound with a molecular weight of approxim...

Compound Q&A

What industries use 1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine (CAS: 340041-91-0)?

1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine is primarily used in the pharmaceutical industry as an interm...

Compound Q&A

What precautions should be taken when handling 1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine (CAS: 340041-91-0)?

When handling 1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine (CAS: 340041-91-0), it is important to use pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...