Compound Q&A

What are the physical and chemical properties of 1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine (CAS: 340041-91-0)?

Answer

1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine
1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine is a crystalline compound with a molecular weight of approximately 362.07 g/mol. It has limited water solubility but is more soluble in organic solvents like ethanol and acetone. The compound is known for its reactivity towards nucleophiles and its stability in acidic environments. It is sparingly soluble in water and readily soluble in organic solvents.

About

English Name 1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine
Molecular Formula C11H14N2O4S
Molecular Weight 270.31 g/mol
SMILES C1CCN(C1)S(=O)(=O)CC2=CC=C(C=C2)[N+](=O)[O-]
InChIKey RCEYIHLMZBWOJK-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

How is 1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine (CAS: 340041-91-0) typically synthesized?

1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine is typically synthesized through the condensation of 4-nitrob...

Compound Q&A

What industries use 1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine (CAS: 340041-91-0)?

1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine is primarily used in the pharmaceutical industry as an interm...

Compound Q&A

What precautions should be taken when handling 1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine (CAS: 340041-91-0)?

When handling 1-[(4-Nitrobenzyl)sulfonyl]pyrrolidine (CAS: 340041-91-0), it is important to use pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...