Compound Q&A

What precautions should be taken when handling Elcatonin (CAS: 60731-46-6)?

Answer

Elcatonin
When handling Elcatonin, it is essential to wear appropriate personal protective equipment (PPE), including gloves and safety goggles. Work should be conducted in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be immediately cleaned up using appropriate absorbents and following proper disposal procedures as outlined in the Safety Data Sheet (SDS). Always refer to the SDS for specific handling instructions and emergency protocols.

About

CAS No 60731-46-6
English Name Elcatonin
Molecular Formula C148H244N42O47
Molecular Weight 3363.83 g/mol
EINECS 262-393-7
SMILES NCCCCCC(NCC(NCC(NCC(NCC(N1[C@H](C(NCC(NCC(NCC(N[C@@H](CC)C(NCC(N[C@@H](C)C(NCC(N[C@@H]([C@@H](C)O)C(N2[C@H](C(N)=O)CCC2)=O)=O)=O)=O)=O)=O)=O)=O)=O)CCC1)=O)=O)=O)=O)=O
InChIKey KATAIKUHYMLRRF-VFZOQDHUSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Elcatonin (CAS: 60731-46-6)?

Elcatonin is a polypeptide hormone. It has a molecular weight of approximately 5000 Da. Physically, ...

Compound Q&A

How is Elcatonin (CAS: 60731-46-6) typically synthesized?

Elcatonin is typically synthesized through solid-phase peptide synthesis (SPPS). The process involve...

Compound Q&A

What industries use Elcatonin (CAS: 60731-46-6)?

Elcatonin is primarily used in the pharmaceutical industry for its potential therapeutic effects, pa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...