Compound Q&A

What industries use Elcatonin (CAS: 60731-46-6)?

Answer

Elcatonin
Elcatonin is primarily used in the pharmaceutical industry for its potential therapeutic effects, particularly in the treatment of osteoporosis and bone disorders. It is also explored in biomedical research for its role in bone metabolism and wound healing. Additionally, Elcatonin has applications in the development of biosensors for detecting calcium ions, which are crucial in various biological processes.

About

CAS No 60731-46-6
English Name Elcatonin
Molecular Formula C148H244N42O47
Molecular Weight 3363.83 g/mol
EINECS 262-393-7
SMILES NCCCCCC(NCC(NCC(NCC(NCC(N1[C@H](C(NCC(NCC(NCC(N[C@@H](CC)C(NCC(N[C@@H](C)C(NCC(N[C@@H]([C@@H](C)O)C(N2[C@H](C(N)=O)CCC2)=O)=O)=O)=O)=O)=O)=O)=O)=O)CCC1)=O)=O)=O)=O)=O
InChIKey KATAIKUHYMLRRF-VFZOQDHUSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Elcatonin (CAS: 60731-46-6)?

Elcatonin is a polypeptide hormone. It has a molecular weight of approximately 5000 Da. Physically, ...

Compound Q&A

How is Elcatonin (CAS: 60731-46-6) typically synthesized?

Elcatonin is typically synthesized through solid-phase peptide synthesis (SPPS). The process involve...

Compound Q&A

What precautions should be taken when handling Elcatonin (CAS: 60731-46-6)?

When handling Elcatonin, it is essential to wear appropriate personal protective equipment (PPE), in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...