Compound Q&A

What are the physical and chemical properties of Elcatonin (CAS: 60731-46-6)?

Answer

Elcatonin
Elcatonin is a polypeptide hormone. It has a molecular weight of approximately 5000 Da. Physically, it is a white to off-white crystalline powder. It is slightly soluble in water, with a solubility of about 1 mg/mL at 25°C. Chemically, it is relatively stable but can be hydrolyzed by acid or base. Elcatonin is known for its reactivity in basic conditions, making it important to maintain a neutral pH during storage and handling.

About

CAS No 60731-46-6
English Name Elcatonin
Molecular Formula C148H244N42O47
Molecular Weight 3363.83 g/mol
EINECS 262-393-7
SMILES NCCCCCC(NCC(NCC(NCC(NCC(N1[C@H](C(NCC(NCC(NCC(N[C@@H](CC)C(NCC(N[C@@H](C)C(NCC(N[C@@H]([C@@H](C)O)C(N2[C@H](C(N)=O)CCC2)=O)=O)=O)=O)=O)=O)=O)=O)=O)CCC1)=O)=O)=O)=O)=O
InChIKey KATAIKUHYMLRRF-VFZOQDHUSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

How is Elcatonin (CAS: 60731-46-6) typically synthesized?

Elcatonin is typically synthesized through solid-phase peptide synthesis (SPPS). The process involve...

Compound Q&A

What industries use Elcatonin (CAS: 60731-46-6)?

Elcatonin is primarily used in the pharmaceutical industry for its potential therapeutic effects, pa...

Compound Q&A

What precautions should be taken when handling Elcatonin (CAS: 60731-46-6)?

When handling Elcatonin, it is essential to wear appropriate personal protective equipment (PPE), in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...