Compound Q&A

What precautions should be taken when handling 7-Bromo-1H-indazole-3-carboxylic acid (CAS: 885278-71-7)?

Answer

7-Bromo-1H-indazole-3-carboxylic acid
When handling 7-Bromo-1H-indazole-3-carboxylic acid, it is important to use appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up carefully, and the area should be properly decontaminated. Always refer to the Safety Data Sheet (SDS) for detailed guidelines and emergency procedures.

About

English Name 7-Bromo-1H-indazole-3-carboxylic acid
Molecular Formula C8H5BrN2O2
Molecular Weight 241.04 g/mol
SMILES C1=CC2=C(NN=C2C(=C1)Br)C(=O)O
InChIKey HJSGTNVPWFFHOJ-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Bromo-1H-indazole-3-carboxylic acid (CAS: 885278-71-7)?

7-Bromo-1H-indazole-3-carboxylic acid is a crystalline solid with a molecular weight of 267.04 g/mol...

Compound Q&A

How is 7-Bromo-1H-indazole-3-carboxylic acid (CAS: 885278-71-7) typically synthesized?

7-Bromo-1H-indazole-3-carboxylic acid is typically synthesized through a bromination reaction of 1H-...

Compound Q&A

What industries use 7-Bromo-1H-indazole-3-carboxylic acid (CAS: 885278-71-7)?

7-Bromo-1H-indazole-3-carboxylic acid is used in various industries, including pharmaceuticals, wher...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...