Compound Q&A

What industries use 7-Bromo-1H-indazole-3-carboxylic acid (CAS: 885278-71-7)?

Answer

7-Bromo-1H-indazole-3-carboxylic acid
7-Bromo-1H-indazole-3-carboxylic acid is used in various industries, including pharmaceuticals, where it serves as an intermediate for the synthesis of drugs with potential therapeutic applications. It also finds use in the polymer industry for the development of new materials and in the sensor industry for the fabrication of chemical sensors. Additionally, it is explored in the semiconductor industry for specific applications.

About

English Name 7-Bromo-1H-indazole-3-carboxylic acid
Molecular Formula C8H5BrN2O2
Molecular Weight 241.04 g/mol
SMILES C1=CC2=C(NN=C2C(=C1)Br)C(=O)O
InChIKey HJSGTNVPWFFHOJ-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Bromo-1H-indazole-3-carboxylic acid (CAS: 885278-71-7)?

7-Bromo-1H-indazole-3-carboxylic acid is a crystalline solid with a molecular weight of 267.04 g/mol...

Compound Q&A

How is 7-Bromo-1H-indazole-3-carboxylic acid (CAS: 885278-71-7) typically synthesized?

7-Bromo-1H-indazole-3-carboxylic acid is typically synthesized through a bromination reaction of 1H-...

Compound Q&A

What precautions should be taken when handling 7-Bromo-1H-indazole-3-carboxylic acid (CAS: 885278-71-7)?

When handling 7-Bromo-1H-indazole-3-carboxylic acid, it is important to use appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...