Compound Q&A

How is 7-Bromo-1H-indazole-3-carboxylic acid (CAS: 885278-71-7) typically synthesized?

Answer

7-Bromo-1H-indazole-3-carboxylic acid
7-Bromo-1H-indazole-3-carboxylic acid is typically synthesized through a bromination reaction of 1H-indazole-3-carboxylic acid or its derivates. This process involves the use of a brominating agent like N-bromosuccinimide (NBS) in the presence of a suitable catalyst such as azobisisobutyronitrile (AIBN) under UV light. The yield is moderate, and the method is selective for the bromination at the indazole ring.

About

English Name 7-Bromo-1H-indazole-3-carboxylic acid
Molecular Formula C8H5BrN2O2
Molecular Weight 241.04 g/mol
SMILES C1=CC2=C(NN=C2C(=C1)Br)C(=O)O
InChIKey HJSGTNVPWFFHOJ-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Bromo-1H-indazole-3-carboxylic acid (CAS: 885278-71-7)?

7-Bromo-1H-indazole-3-carboxylic acid is a crystalline solid with a molecular weight of 267.04 g/mol...

Compound Q&A

What industries use 7-Bromo-1H-indazole-3-carboxylic acid (CAS: 885278-71-7)?

7-Bromo-1H-indazole-3-carboxylic acid is used in various industries, including pharmaceuticals, wher...

Compound Q&A

What precautions should be taken when handling 7-Bromo-1H-indazole-3-carboxylic acid (CAS: 885278-71-7)?

When handling 7-Bromo-1H-indazole-3-carboxylic acid, it is important to use appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...