Compound Q&A

What are the physical and chemical properties of 7-Bromo-1H-indazole-3-carboxylic acid (CAS: 885278-71-7)?

Answer

7-Bromo-1H-indazole-3-carboxylic acid
7-Bromo-1H-indazole-3-carboxylic acid is a crystalline solid with a molecular weight of 267.04 g/mol. It has a low solubility in water (0.01 g/100 mL at 20°C) and is more soluble in organic solvents like methanol and acetonitrile. The compound shows moderate reactivity under basic conditions and is relatively stable under acidic conditions. It is known for its poor solubility and weak basicity.

About

English Name 7-Bromo-1H-indazole-3-carboxylic acid
Molecular Formula C8H5BrN2O2
Molecular Weight 241.04 g/mol
SMILES C1=CC2=C(NN=C2C(=C1)Br)C(=O)O
InChIKey HJSGTNVPWFFHOJ-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

How is 7-Bromo-1H-indazole-3-carboxylic acid (CAS: 885278-71-7) typically synthesized?

7-Bromo-1H-indazole-3-carboxylic acid is typically synthesized through a bromination reaction of 1H-...

Compound Q&A

What industries use 7-Bromo-1H-indazole-3-carboxylic acid (CAS: 885278-71-7)?

7-Bromo-1H-indazole-3-carboxylic acid is used in various industries, including pharmaceuticals, wher...

Compound Q&A

What precautions should be taken when handling 7-Bromo-1H-indazole-3-carboxylic acid (CAS: 885278-71-7)?

When handling 7-Bromo-1H-indazole-3-carboxylic acid, it is important to use appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...