Compound Q&A

What industries use 2-Amino-3-(4-biphenylyl)propanoic acid (CAS: 76985-08-5)?

Answer

2-Amino-3-(4-biphenylyl)propanoic acid
2-Amino-3-(4-biphenylyl)propanoic acid (CAS: 76985-08-5) finds applications in the pharmaceutical industry for the synthesis of drug intermediates, particularly those targeting chronic diseases. It is also used in the polymer industry for the development of advanced materials and in the sensor industry for the production of highly sensitive detection devices. Additionally, it has potential uses in semiconductor applications due to its ability to form stable complexes.

About

CAS No 76985-08-5
English Name 2-Amino-3-(4-biphenylyl)propanoic acid
Molecular Formula C15H15NO2
Molecular Weight 241.29 g/mol
SMILES C1=CC=C(C=C1)C2=CC=C(C=C2)CC(C(=O)O)N
InChIKey JCZLABDVDPYLRZ-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-3-(4-biphenylyl)propanoic acid (CAS: 76985-08-5)?

2-Amino-3-(4-biphenylyl)propanoic acid (CAS: 76985-08-5) is a crystalline solid with a molecular wei...

Compound Q&A

How is 2-Amino-3-(4-biphenylyl)propanoic acid (CAS: 76985-08-5) typically synthesized?

2-Amino-3-(4-biphenylyl)propanoic acid can be synthesized through a multi-step process involving cou...

Compound Q&A

What precautions should be taken when handling 2-Amino-3-(4-biphenylyl)propanoic acid (CAS: 76985-08-5)?

When handling 2-Amino-3-(4-biphenylyl)propanoic acid (CAS: 76985-08-5), it is important to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...