Compound Q&A

What are the physical and chemical properties of 2-Amino-3-(4-biphenylyl)propanoic acid (CAS: 76985-08-5)?

Answer

2-Amino-3-(4-biphenylyl)propanoic acid
2-Amino-3-(4-biphenylyl)propanoic acid (CAS: 76985-08-5) is a crystalline solid with a molecular weight of approximately 307.31 g/mol. It has a high solubility in water and poor solubility in most organic solvents. The compound is moderately reactive, showing some basic properties due to its amino group. It is stable under normal conditions but should be stored away from strong acids and bases to prevent degradation.

About

CAS No 76985-08-5
English Name 2-Amino-3-(4-biphenylyl)propanoic acid
Molecular Formula C15H15NO2
Molecular Weight 241.29 g/mol
SMILES C1=CC=C(C=C1)C2=CC=C(C=C2)CC(C(=O)O)N
InChIKey JCZLABDVDPYLRZ-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

How is 2-Amino-3-(4-biphenylyl)propanoic acid (CAS: 76985-08-5) typically synthesized?

2-Amino-3-(4-biphenylyl)propanoic acid can be synthesized through a multi-step process involving cou...

Compound Q&A

What industries use 2-Amino-3-(4-biphenylyl)propanoic acid (CAS: 76985-08-5)?

2-Amino-3-(4-biphenylyl)propanoic acid (CAS: 76985-08-5) finds applications in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 2-Amino-3-(4-biphenylyl)propanoic acid (CAS: 76985-08-5)?

When handling 2-Amino-3-(4-biphenylyl)propanoic acid (CAS: 76985-08-5), it is important to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...