Compound Q&A

What industries use Ethyl 2,4-dihydroxy-6-methylnicotinate (CAS: 10350-10-4)?

Answer

Ethyl 2,4-dihydroxy-6-methylnicotinate
Ethyl 2,4-dihydroxy-6-methylnicotinate finds applications in the pharmaceutical industry as an intermediate in the synthesis of certain drugs. It is also used in the development of sensors and semiconductors due to its specific chemical reactivity and stability. In the polymer industry, it can be utilized as a functional monomer or additive.

About

CAS No 10350-10-4
English Name Ethyl 2,4-dihydroxy-6-methylnicotinate
Molecular Formula C9H11NO4
Molecular Weight 197.19 g/mol
SMILES CCOC(=O)C1=C(C=C(NC1=O)C)O
InChIKey CMCZAWPDHHYFPU-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2,4-dihydroxy-6-methylnicotinate (CAS: 10350-10-4)?

Ethyl 2,4-dihydroxy-6-methylnicotinate is a white crystalline solid with a molecular weight of appro...

Compound Q&A

How is Ethyl 2,4-dihydroxy-6-methylnicotinate (CAS: 10350-10-4) typically synthesized?

Ethyl 2,4-dihydroxy-6-methylnicotinate is typically synthesized through the condensation of 2,4-dihy...

Compound Q&A

What precautions should be taken when handling Ethyl 2,4-dihydroxy-6-methylnicotinate (CAS: 10350-10-4)?

When handling Ethyl 2,4-dihydroxy-6-methylnicotinate, appropriate personal protective equipment (PPE...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...