Compound Q&A

What are the physical and chemical properties of Ethyl 2,4-dihydroxy-6-methylnicotinate (CAS: 10350-10-4)?

Answer

Ethyl 2,4-dihydroxy-6-methylnicotinate
Ethyl 2,4-dihydroxy-6-methylnicotinate is a white crystalline solid with a molecular weight of approximately 228.2 g/mol. It is slightly soluble in water and ethanol, but more soluble in organic solvents such as methanol and acetone. The compound exhibits moderate reactivity, particularly towards acid and base catalyzed reactions, and it is known for its stability under normal storage conditions.

About

CAS No 10350-10-4
English Name Ethyl 2,4-dihydroxy-6-methylnicotinate
Molecular Formula C9H11NO4
Molecular Weight 197.19 g/mol
SMILES CCOC(=O)C1=C(C=C(NC1=O)C)O
InChIKey CMCZAWPDHHYFPU-UHFFFAOYSA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

How is Ethyl 2,4-dihydroxy-6-methylnicotinate (CAS: 10350-10-4) typically synthesized?

Ethyl 2,4-dihydroxy-6-methylnicotinate is typically synthesized through the condensation of 2,4-dihy...

Compound Q&A

What industries use Ethyl 2,4-dihydroxy-6-methylnicotinate (CAS: 10350-10-4)?

Ethyl 2,4-dihydroxy-6-methylnicotinate finds applications in the pharmaceutical industry as an inter...

Compound Q&A

What precautions should be taken when handling Ethyl 2,4-dihydroxy-6-methylnicotinate (CAS: 10350-10-4)?

When handling Ethyl 2,4-dihydroxy-6-methylnicotinate, appropriate personal protective equipment (PPE...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...