Compound Q&A

What precautions should be taken when handling (R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2)?

Answer

(R)-1-Boc-3-isopropyl-piperazine
When handling (R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2), it is essential to use appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Work should be conducted in a fume hood to minimize exposure. Spills should be cleaned up immediately and disposed of according to local regulations. Always consult the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

English Name (R)-1-Boc-3-isopropyl-piperazine
Molecular Formula C12H24N2O2
Molecular Weight 228.34 g/mol
SMILES CC(C)C1CN(CCN1)C(=O)OC(C)(C)C
InChIKey UHLAQCKNCBYTIF-JTQLQIEISA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of (R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2)?

(R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2) is a white crystalline solid with a molecular we...

Compound Q&A

How is (R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2) typically synthesized?

(R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2) is typically synthesized via a multistep process...

Compound Q&A

What industries use (R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2)?

(R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2) is primarily used in the pharmaceutical industry...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...