Compound Q&A

What are the physical and chemical properties of (R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2)?

Answer

(R)-1-Boc-3-isopropyl-piperazine
(R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2) is a white crystalline solid with a molecular weight of approximately 226.37 g/mol. It has a solubility of about 20 mg/mL in water and is practically insoluble in ethanol. The compound is less reactive than other piperazine derivatives but can undergo nucleophilic substitution reactions. It has good stability under normal conditions.

About

English Name (R)-1-Boc-3-isopropyl-piperazine
Molecular Formula C12H24N2O2
Molecular Weight 228.33599999999996 g/mol
SMILES CC(C)C1CN(CCN1)C(=O)OC(C)(C)C
InChIKey UHLAQCKNCBYTIF-JTQLQIEISA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

How is (R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2) typically synthesized?

(R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2) is typically synthesized via a multistep process...

Compound Q&A

What industries use (R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2)?

(R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2) is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling (R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2)?

When handling (R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2), it is essential to use appropriat...

Compound Q&A

How is 1-(2-Naphthyl)-1H-pyrrole-2,5-dione (CAS: 6637-45-2) typically synthesized?

1-(2-Naphthyl)-1H-pyrrole-2,5-dione (CAS: 6637-45-2) can be synthesized through ...

6637-45-21-(2-Naphthyl)-1H-py...
Compound Q&A

What is Diisodecyl phthalate (CAS: 68515-49-1)?

Diisodecyl phthalate (DIDP) is a clear, colorless, and odorless liquid with a CA...

68515-49-1Diisodecyl phthalate
1189172-05-1(trans-racemic)-Meth...
Compound Q&A

What are the main uses of (Ala13)-Apelin-13 (CAS: 568565-11-7)?

(Ala13)-Apelin-13 is primarily used in research for studying the apelin receptor...

568565-11-7(Ala13)-Apelin-13 (h...