Compound Q&A

What industries use (R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2)?

Answer

(R)-1-Boc-3-isopropyl-piperazine
(R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2) is primarily used in the pharmaceutical industry for the development of various chemical intermediates and potential drug candidates. It is also explored in polymer chemistry for the synthesis of functional polymers and in sensor technology for its specific binding properties.

About

English Name (R)-1-Boc-3-isopropyl-piperazine
Molecular Formula C12H24N2O2
Molecular Weight 228.33599999999996 g/mol
SMILES CC(C)C1CN(CCN1)C(=O)OC(C)(C)C
InChIKey UHLAQCKNCBYTIF-JTQLQIEISA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of (R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2)?

(R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2) is a white crystalline solid with a molecular we...

Compound Q&A

How is (R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2) typically synthesized?

(R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2) is typically synthesized via a multistep process...

Compound Q&A

What precautions should be taken when handling (R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2)?

When handling (R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2), it is essential to use appropriat...

Compound Q&A

How is 1-(2-Naphthyl)-1H-pyrrole-2,5-dione (CAS: 6637-45-2) typically synthesized?

1-(2-Naphthyl)-1H-pyrrole-2,5-dione (CAS: 6637-45-2) can be synthesized through ...

6637-45-21-(2-Naphthyl)-1H-py...
Compound Q&A

What is Diisodecyl phthalate (CAS: 68515-49-1)?

Diisodecyl phthalate (DIDP) is a clear, colorless, and odorless liquid with a CA...

68515-49-1Diisodecyl phthalate
1189172-05-1(trans-racemic)-Meth...
Compound Q&A

What are the main uses of (Ala13)-Apelin-13 (CAS: 568565-11-7)?

(Ala13)-Apelin-13 is primarily used in research for studying the apelin receptor...

568565-11-7(Ala13)-Apelin-13 (h...