Compound Q&A

How is (R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2) typically synthesized?

Answer

(R)-1-Boc-3-isopropyl-piperazine
(R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2) is typically synthesized via a multistep process that involves the protection of the amino group with a Boc group and subsequent isopropylation. Common reagents include Boc anhydride and isopropyl iodide. The synthesis yields are typically around 85%, with high selectivity and excellent purity.

About

English Name (R)-1-Boc-3-isopropyl-piperazine
Molecular Formula C12H24N2O2
Molecular Weight 228.33599999999996 g/mol
SMILES CC(C)C1CN(CCN1)C(=O)OC(C)(C)C
InChIKey UHLAQCKNCBYTIF-JTQLQIEISA-N
Last Updated: 2025-10-31 17:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of (R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2)?

(R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2) is a white crystalline solid with a molecular we...

Compound Q&A

What industries use (R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2)?

(R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2) is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling (R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2)?

When handling (R)-1-Boc-3-isopropyl-piperazine (CAS: 928025-63-2), it is essential to use appropriat...

Compound Q&A

How is 1-(2-Naphthyl)-1H-pyrrole-2,5-dione (CAS: 6637-45-2) typically synthesized?

1-(2-Naphthyl)-1H-pyrrole-2,5-dione (CAS: 6637-45-2) can be synthesized through ...

6637-45-21-(2-Naphthyl)-1H-py...
Compound Q&A

What is Diisodecyl phthalate (CAS: 68515-49-1)?

Diisodecyl phthalate (DIDP) is a clear, colorless, and odorless liquid with a CA...

68515-49-1Diisodecyl phthalate
1189172-05-1(trans-racemic)-Meth...
Compound Q&A

What are the main uses of (Ala13)-Apelin-13 (CAS: 568565-11-7)?

(Ala13)-Apelin-13 is primarily used in research for studying the apelin receptor...

568565-11-7(Ala13)-Apelin-13 (h...