Compound Q&A

What precautions should be taken when handling (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-8-[(2-methyl-2-propanyl)oxy]-8-oxooctanoic acid (CAS: 276869-41-1)?

Answer

(2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-8-[(2-methyl-2-propanyl)oxy]-8-oxooctanoic acid
When handling this compound, ensure the use of proper personal protective equipment (PPE) including gloves, goggles, and a lab coat. Work should be conducted in a fume hood due to its reactivity. Spills should be cleaned up immediately using appropriate absorbent materials, and the area should be well-ventilated. Refer to the safety data sheet (SDS) for detailed information on handling procedures and emergency response.

About

English Name (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-8-[(2-methyl-2-propanyl)oxy]-8-oxooctanoic acid
Molecular Formula C27H33NO6
Molecular Weight 467.56 g/mol
SMILES O=C(O)[C@@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)CCCCCC(OC(C)(C)C)=O
InChIKey ULPCAXORIFXUMN-QHCPKHFHSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-8-[(2-methyl-2-propanyl)oxy]-8-oxooctanoic acid (CAS: 276869-41-1)?

This compound is an amino acid derivative with a molecular weight of approximately 483.33 g/mol. It ...

Compound Q&A

How is (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-8-[(2-methyl-2-propanyl)oxy]-8-oxooctanoic acid (CAS: 276869-41-1) typically synthesized?

This compound is typically synthesized through the condensation of fluorenylmethanol and α-(2-methyl...

Compound Q&A

What industries use (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-8-[(2-methyl-2-propanyl)oxy]-8-oxooctanoic acid (CAS: 276869-41-1)?

This compound finds applications in pharmaceuticals, particularly in the development of new drugs, a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...