Compound Q&A

What industries use (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-8-[(2-methyl-2-propanyl)oxy]-8-oxooctanoic acid (CAS: 276869-41-1)?

Answer

(2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-8-[(2-methyl-2-propanyl)oxy]-8-oxooctanoic acid
This compound finds applications in pharmaceuticals, particularly in the development of new drugs, and in the synthesis of polymers for various industrial uses. It is also used in the production of sensors and as a key intermediate in semiconductor manufacturing due to its reactivity and specific functionality.

About

English Name (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-8-[(2-methyl-2-propanyl)oxy]-8-oxooctanoic acid
Molecular Formula C27H33NO6
Molecular Weight 467.56 g/mol
SMILES O=C(O)[C@@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)CCCCCC(OC(C)(C)C)=O
InChIKey ULPCAXORIFXUMN-QHCPKHFHSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-8-[(2-methyl-2-propanyl)oxy]-8-oxooctanoic acid (CAS: 276869-41-1)?

This compound is an amino acid derivative with a molecular weight of approximately 483.33 g/mol. It ...

Compound Q&A

How is (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-8-[(2-methyl-2-propanyl)oxy]-8-oxooctanoic acid (CAS: 276869-41-1) typically synthesized?

This compound is typically synthesized through the condensation of fluorenylmethanol and α-(2-methyl...

Compound Q&A

What precautions should be taken when handling (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-8-[(2-methyl-2-propanyl)oxy]-8-oxooctanoic acid (CAS: 276869-41-1)?

When handling this compound, ensure the use of proper personal protective equipment (PPE) including ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...