Compound Q&A

What are the physical and chemical properties of (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-8-[(2-methyl-2-propanyl)oxy]-8-oxooctanoic acid (CAS: 276869-41-1)?

Answer

(2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-8-[(2-methyl-2-propanyl)oxy]-8-oxooctanoic acid
This compound is an amino acid derivative with a molecular weight of approximately 483.33 g/mol. It is sparingly soluble in water but has good solubility in organic solvents such as ethanol and dichloromethane. It exhibits high reactivity due to the presence of the amino and ester functionalities. Its crystalline form allows for stable storage conditions, but it is sensitive to moisture and heat, which can lead to degradation.

About

English Name (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-8-[(2-methyl-2-propanyl)oxy]-8-oxooctanoic acid
Molecular Formula C27H33NO6
Molecular Weight 467.56 g/mol
SMILES O=C(O)[C@@H](NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)CCCCCC(OC(C)(C)C)=O
InChIKey ULPCAXORIFXUMN-QHCPKHFHSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

How is (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-8-[(2-methyl-2-propanyl)oxy]-8-oxooctanoic acid (CAS: 276869-41-1) typically synthesized?

This compound is typically synthesized through the condensation of fluorenylmethanol and α-(2-methyl...

Compound Q&A

What industries use (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-8-[(2-methyl-2-propanyl)oxy]-8-oxooctanoic acid (CAS: 276869-41-1)?

This compound finds applications in pharmaceuticals, particularly in the development of new drugs, a...

Compound Q&A

What precautions should be taken when handling (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-8-[(2-methyl-2-propanyl)oxy]-8-oxooctanoic acid (CAS: 276869-41-1)?

When handling this compound, ensure the use of proper personal protective equipment (PPE) including ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...