Compound Q&A

What precautions should be taken when handling 5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7)?

Answer

5-Bromo-2-chlorobenzoyl chloride
When handling 5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7), it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize inhalation. Spills should be cleaned up immediately using appropriate absorbents, and the area should be flushed with water. Always refer to the safety data sheet (SDS) for detailed handling and storage instructions.

About

CAS No 21900-52-7
English Name 5-Bromo-2-chlorobenzoyl chloride
Molecular Formula C7H3BrCl2O
Molecular Weight 253.91 g/mol
SMILES C1=CC(=C(C=C1Br)C(=O)Cl)Cl
InChIKey TZIQQJRRMJWMDI-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:22

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7)?

5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7) is a crystalline solid with a molecular weight of...

Compound Q&A

How is 5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7) typically synthesized?

5-Bromo-2-chlorobenzoyl chloride is typically synthesized via a multi-step process involving the bro...

Compound Q&A

What industries use 5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7)?

5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7) finds application in the pharmaceutical, polymer,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...