Compound Q&A

What industries use 5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7)?

Answer

5-Bromo-2-chlorobenzoyl chloride
5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7) finds application in the pharmaceutical, polymer, and chemical synthesis industries. It is used as an intermediate in the synthesis of drugs, polymers, and other organic compounds. Its reactivity makes it valuable for producing functionalized organic molecules with specific properties.

About

CAS No 21900-52-7
English Name 5-Bromo-2-chlorobenzoyl chloride
Molecular Formula C7H3BrCl2O
Molecular Weight 253.91 g/mol
SMILES C1=CC(=C(C=C1Br)C(=O)Cl)Cl
InChIKey TZIQQJRRMJWMDI-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:22

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7)?

5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7) is a crystalline solid with a molecular weight of...

Compound Q&A

How is 5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7) typically synthesized?

5-Bromo-2-chlorobenzoyl chloride is typically synthesized via a multi-step process involving the bro...

Compound Q&A

What precautions should be taken when handling 5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7)?

When handling 5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7), it is essential to use personal pr...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...