Compound Q&A

What are the physical and chemical properties of 5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7)?

Answer

5-Bromo-2-chlorobenzoyl chloride
5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7) is a crystalline solid with a molecular weight of approximately 249.02 g/mol. It has a low solubility in water but is soluble in common organic solvents like dichloromethane, acetone, and ethanol. This compound is reactive, particularly towards nucleophiles, making it useful in various chemical transformations. It is stable under normal conditions but should be stored away from moisture to prevent hydrolysis.

About

CAS No 21900-52-7
English Name 5-Bromo-2-chlorobenzoyl chloride
Molecular Formula C7H3BrCl2O
Molecular Weight 253.91 g/mol
SMILES C1=CC(=C(C=C1Br)C(=O)Cl)Cl
InChIKey TZIQQJRRMJWMDI-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:22

Related Q&A

Compound Q&A

How is 5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7) typically synthesized?

5-Bromo-2-chlorobenzoyl chloride is typically synthesized via a multi-step process involving the bro...

Compound Q&A

What industries use 5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7)?

5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7) finds application in the pharmaceutical, polymer,...

Compound Q&A

What precautions should be taken when handling 5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7)?

When handling 5-Bromo-2-chlorobenzoyl chloride (CAS: 21900-52-7), it is essential to use personal pr...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...